C12H15N3O6S — CID 120964052
1-[4-(methylsulfamoyl)-2-nitrophenyl]pyrrolidine-3-carboxylic acid (PubChem CID 120964052) has the molecular formula C12H15N3O6S and a molecular weight of 329.33 g/mol. Its IUPAC name is 1-[4-(methylsulfamoyl)-2-nitrophenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-(methylsulfamoyl)-2-nitrophenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120964052 |
| Molecular Formula | C12H15N3O6S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1-[4-(methylsulfamoyl)-2-nitrophenyl]pyrrolidine-3-carboxylic acid |
| SMILES | CNS(=O)(=O)c1ccc(N2CCC(C(=O)O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N3O6S/c1-13-22(20,21)9-2-3-10(11(6-9)15(18)19)14-5-4-8(7-14)12(16)17/h2-3,6,8,13H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | ILYKTRVMYPFAQV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|