C12H12F3N3O5S — CID 60507617
1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 60507617) has the molecular formula C12H12F3N3O5S and a molecular weight of 367.31 g/mol. Its IUPAC name is 1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 60507617 |
| Molecular Formula | C12H12F3N3O5S |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 1-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CCN(c2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H12F3N3O5S/c13-12(14,15)24(22,23)8-1-2-9(10(5-8)18(20)21)17-4-3-7(6-17)11(16)19/h1-2,5,7H,3-4,6H2,(H2,16,19) |
| InChIKey | NUGRZEPIBLXKQF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|