C13H15F3N2O5S — CID 36722781
(2R)-2-ethyl-4-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]morpholine (PubChem CID 36722781) has the molecular formula C13H15F3N2O5S and a molecular weight of 368.33 g/mol. Its IUPAC name is (2R)-2-ethyl-4-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]morpholine.
| Compound Name | (2R)-2-ethyl-4-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]morpholine |
|---|---|
| PubChem CID | 36722781 |
| Molecular Formula | C13H15F3N2O5S |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (2R)-2-ethyl-4-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]morpholine |
| SMILES | CC[C@@H]1CN(c2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])CCO1 |
| InChI | InChI=1S/C13H15F3N2O5S/c1-2-9-8-17(5-6-23-9)11-4-3-10(7-12(11)18(19)20)24(21,22)13(14,15)16/h3-4,7,9H,2,5-6,8H2,1H3/t9-/m1/s1 |
| InChIKey | NLJREYZGDKFHRI-SECBINFHSA-N |
| XLogP | 2.50 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|