C17H22F3N3O5S — CID 98768511
1-[(2R,5S)-2,5-diethyl-4-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 98768511) has the molecular formula C17H22F3N3O5S and a molecular weight of 437.44 g/mol. Its IUPAC name is 1-[(2R,5S)-2,5-diethyl-4-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[(2R,5S)-2,5-diethyl-4-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 98768511 |
| Molecular Formula | C17H22F3N3O5S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-[(2R,5S)-2,5-diethyl-4-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | CC[C@@H]1CN(c2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])[C@@H](CC)CN1C(C)=O |
| InChI | InChI=1S/C17H22F3N3O5S/c1-4-12-10-22(13(5-2)9-21(12)11(3)24)15-7-6-14(8-16(15)23(25)26)29(27,28)17(18,19)20/h6-8,12-13H,4-5,9-10H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | PPXHTLFNVFVMCL-OLZOCXBDSA-N |
| XLogP | 3.11 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|