C9H6F3NO7S2 — CID 11863376
2-[(S)-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinyl]acetic acid (PubChem CID 11863376) has the molecular formula C9H6F3NO7S2 and a molecular weight of 361.28 g/mol. Its IUPAC name is 2-[(S)-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinyl]acetic acid.
| Compound Name | 2-[(S)-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinyl]acetic acid |
|---|---|
| PubChem CID | 11863376 |
| Molecular Formula | C9H6F3NO7S2 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | 2-[(S)-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinyl]acetic acid |
| SMILES | O=C(O)C[S@](=O)c1ccc(S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6F3NO7S2/c10-9(11,12)22(19,20)5-1-2-7(6(3-5)13(16)17)21(18)4-8(14)15/h1-3H,4H2,(H,14,15)/t21-/m0/s1 |
| InChIKey | GFHDEMKWKGPIEW-NRFANRHFSA-N |
| XLogP | 1.08 |
| TPSA | 131.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|