C19H18F3N3O6S2 — CID 11918436
2-[(R)-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinyl]-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 11918436) has the molecular formula C19H18F3N3O6S2 and a molecular weight of 505.50 g/mol. Its IUPAC name is 2-[(R)-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinyl]-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(R)-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinyl]-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 11918436 |
| Molecular Formula | C19H18F3N3O6S2 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2-[(R)-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinyl]-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(C[S@@](=O)c1ccc(S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-])N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H18F3N3O6S2/c20-19(21,22)33(30,31)15-6-7-17(16(12-15)25(27)28)32(29)13-18(26)24-10-8-23(9-11-24)14-4-2-1-3-5-14/h1-7,12H,8-11,13H2/t32-/m1/s1 |
| InChIKey | MISBPIXSCSWYHI-JGCGQSQUSA-N |
| XLogP | 2.34 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|