C14H19N3O4S2 — CID 21209870
1-(4-methylpiperazin-1-yl)-2-(4-methylsulfanyl-2-nitrophenyl)sulfinylethanone (PubChem CID 21209870) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2-(4-methylsulfanyl-2-nitrophenyl)sulfinylethanone.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2-(4-methylsulfanyl-2-nitrophenyl)sulfinylethanone |
|---|---|
| PubChem CID | 21209870 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2-(4-methylsulfanyl-2-nitrophenyl)sulfinylethanone |
| SMILES | CSc1ccc(S(=O)CC(=O)N2CCN(C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-15-5-7-16(8-6-15)14(18)10-23(21)13-4-3-11(22-2)9-12(13)17(19)20/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | XKEVBDOERJKSDQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|