C13H18FN3O2S — CID 81191414
2-(4-amino-2-fluorophenyl)sulfinyl-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 81191414) has the molecular formula C13H18FN3O2S and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(4-amino-2-fluorophenyl)sulfinyl-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(4-amino-2-fluorophenyl)sulfinyl-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 81191414 |
| Molecular Formula | C13H18FN3O2S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-(4-amino-2-fluorophenyl)sulfinyl-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CS(=O)c2ccc(N)cc2F)CC1 |
| InChI | InChI=1S/C13H18FN3O2S/c1-16-4-6-17(7-5-16)13(18)9-20(19)12-3-2-10(15)8-11(12)14/h2-3,8H,4-7,9,15H2,1H3 |
| InChIKey | MFKNOTQEDPIMKM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|