C14H16F3N3O4S2 — CID 21209871
1-(4-methylpiperazin-1-yl)-2-[2-nitro-4-(trifluoromethylsulfanyl)phenyl]sulfinylethanone (PubChem CID 21209871) has the molecular formula C14H16F3N3O4S2 and a molecular weight of 411.43 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2-[2-nitro-4-(trifluoromethylsulfanyl)phenyl]sulfinylethanone.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2-[2-nitro-4-(trifluoromethylsulfanyl)phenyl]sulfinylethanone |
|---|---|
| PubChem CID | 21209871 |
| Molecular Formula | C14H16F3N3O4S2 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2-[2-nitro-4-(trifluoromethylsulfanyl)phenyl]sulfinylethanone |
| SMILES | CN1CCN(C(=O)CS(=O)c2ccc(SC(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H16F3N3O4S2/c1-18-4-6-19(7-5-18)13(21)9-26(24)12-3-2-10(25-14(15,16)17)8-11(12)20(22)23/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | VNMMCPACYAQCCH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|