C13H13F3N2O7S2 — CID 21209834
1-morpholin-4-yl-2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinylethanone (PubChem CID 21209834) has the molecular formula C13H13F3N2O7S2 and a molecular weight of 430.38 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinylethanone.
| Compound Name | 1-morpholin-4-yl-2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinylethanone |
|---|---|
| PubChem CID | 21209834 |
| Molecular Formula | C13H13F3N2O7S2 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 1-morpholin-4-yl-2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinylethanone |
| SMILES | O=C(CS(=O)c1ccc(S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-])N1CCOCC1 |
| InChI | InChI=1S/C13H13F3N2O7S2/c14-13(15,16)27(23,24)9-1-2-11(10(7-9)18(20)21)26(22)8-12(19)17-3-5-25-6-4-17/h1-2,7H,3-6,8H2 |
| InChIKey | XNBQXFFSPHZUAJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|