C18H9ClF10N2O7S3 — CID 21209936
N-[2-chloro-5-(trifluoromethylsulfonyl)phenyl]-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-nitrophenyl]sulfinylacetamide (PubChem CID 21209936) has the molecular formula C18H9ClF10N2O7S3 and a molecular weight of 686.91 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethylsulfonyl)phenyl]-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-nitrophenyl]sulfinylacetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethylsulfonyl)phenyl]-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-nitrophenyl]sulfinylacetamide |
|---|---|
| PubChem CID | 21209936 |
| Molecular Formula | C18H9ClF10N2O7S3 |
| Molecular Weight | 686.91 g/mol |
| Exact Mass | 685.91 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethylsulfonyl)phenyl]-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-nitrophenyl]sulfinylacetamide |
| SMILES | O=C(CS(=O)c1ccc(S(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1[N+](=O)[O-])Nc1cc(S(=O)(=O)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H9ClF10N2O7S3/c19-10-3-2-9(41(37,38)18(27,28)29)6-11(10)30-14(32)7-39(35)13-4-1-8(5-12(13)31(33)34)40(36)17(25,26)15(20,21)16(22,23)24/h1-6H,7H2,(H,30,32) |
| InChIKey | IUNBXYZMVYEWGD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|