C18H13F7N2O5S3 — CID 21206347
N-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-2-(4-methylsulfinyl-2-nitrophenyl)sulfinylacetamide (PubChem CID 21206347) has the molecular formula C18H13F7N2O5S3 and a molecular weight of 566.50 g/mol. Its IUPAC name is N-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-2-(4-methylsulfinyl-2-nitrophenyl)sulfinylacetamide.
| Compound Name | N-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-2-(4-methylsulfinyl-2-nitrophenyl)sulfinylacetamide |
|---|---|
| PubChem CID | 21206347 |
| Molecular Formula | C18H13F7N2O5S3 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 565.99 |
| IUPAC Name | N-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-2-(4-methylsulfinyl-2-nitrophenyl)sulfinylacetamide |
| SMILES | CS(=O)c1ccc(S(=O)CC(=O)Nc2ccccc2SC(F)(F)C(F)(F)C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13F7N2O5S3/c1-34(31)10-6-7-14(12(8-10)27(29)30)35(32)9-15(28)26-11-4-2-3-5-13(11)33-18(24,25)16(19,20)17(21,22)23/h2-8H,9H2,1H3,(H,26,28) |
| InChIKey | ZCDHVPBBTCSECV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|