C15H10F3N3O6S2 — CID 21206312
2-(2,4-dinitrophenyl)sulfinyl-N-[3-(trifluoromethylsulfanyl)phenyl]acetamide (PubChem CID 21206312) has the molecular formula C15H10F3N3O6S2 and a molecular weight of 449.39 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)sulfinyl-N-[3-(trifluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(2,4-dinitrophenyl)sulfinyl-N-[3-(trifluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 21206312 |
| Molecular Formula | C15H10F3N3O6S2 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | 2-(2,4-dinitrophenyl)sulfinyl-N-[3-(trifluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(CS(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Nc1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C15H10F3N3O6S2/c16-15(17,18)28-11-3-1-2-9(6-11)19-14(22)8-29(27)13-5-4-10(20(23)24)7-12(13)21(25)26/h1-7H,8H2,(H,19,22) |
| InChIKey | AWMBRYBYVASXOL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|