C15H10F3N3O5S — CID 26561922
N-(3-nitrophenyl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 26561922) has the molecular formula C15H10F3N3O5S and a molecular weight of 401.32 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-(3-nitrophenyl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 26561922 |
| Molecular Formula | C15H10F3N3O5S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-(3-nitrophenyl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10F3N3O5S/c16-15(17,18)9-4-5-13(12(6-9)21(25)26)27-8-14(22)19-10-2-1-3-11(7-10)20(23)24/h1-7H,8H2,(H,19,22) |
| InChIKey | LPRWYCAOYOONAG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|