C20H16F3N3O4S — CID 55856131
N-[3-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 55856131) has the molecular formula C20H16F3N3O4S and a molecular weight of 451.43 g/mol. Its IUPAC name is N-[3-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-[3-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 55856131 |
| Molecular Formula | C20H16F3N3O4S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-[3-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)CSc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2)oc1C |
| InChI | InChI=1S/C20H16F3N3O4S/c1-11-12(2)30-19(24-11)13-4-3-5-15(8-13)25-18(27)10-31-17-7-6-14(20(21,22)23)9-16(17)26(28)29/h3-9H,10H2,1-2H3,(H,25,27) |
| InChIKey | JRBWTEOIESGURW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|