C21H16F3N3O5S — CID 55661369
N-[2-(4-methoxyphenoxy)-3-pyridinyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 55661369) has the molecular formula C21H16F3N3O5S and a molecular weight of 479.44 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)-3-pyridinyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-[2-(4-methoxyphenoxy)-3-pyridinyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 55661369 |
| Molecular Formula | C21H16F3N3O5S |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)-3-pyridinyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | COc1ccc(Oc2ncccc2NC(=O)CSc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16F3N3O5S/c1-31-14-5-7-15(8-6-14)32-20-16(3-2-10-25-20)26-19(28)12-33-18-9-4-13(21(22,23)24)11-17(18)27(29)30/h2-11H,12H2,1H3,(H,26,28) |
| InChIKey | XRPGUXCOVTUHGJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|