C18H14F6N2O4S — CID 60575278
N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 60575278) has the molecular formula C18H14F6N2O4S and a molecular weight of 468.38 g/mol. Its IUPAC name is N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 60575278 |
| Molecular Formula | C18H14F6N2O4S |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F6N2O4S/c1-10-2-4-12(14(6-10)30-9-17(19,20)21)25-16(27)8-31-15-5-3-11(18(22,23)24)7-13(15)26(28)29/h2-7H,8-9H2,1H3,(H,25,27) |
| InChIKey | RJEKMMWBEYYYFG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|