C12H10F3N3O3S2 — CID 9454453
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[2-nitro-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 9454453) has the molecular formula C12H10F3N3O3S2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[2-nitro-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[2-nitro-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9454453 |
| Molecular Formula | C12H10F3N3O3S2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[2-nitro-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSC1=NCCS1)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10F3N3O3S2/c13-12(14,15)7-1-2-8(9(5-7)18(20)21)17-10(19)6-23-11-16-3-4-22-11/h1-2,5H,3-4,6H2,(H,17,19) |
| InChIKey | MTDMYLWSDLZHNN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|