C14H11F3N4O3S2 — CID 35770177
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 35770177) has the molecular formula C14H11F3N4O3S2 and a molecular weight of 404.40 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 35770177 |
| Molecular Formula | C14H11F3N4O3S2 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C14H11F3N4O3S2/c15-14(16,17)8-3-4-10(9(5-8)21(23)24)25-6-11(22)18-13-20-19-12(26-13)7-1-2-7/h3-5,7H,1-2,6H2,(H,18,20,22) |
| InChIKey | LILKUECTIXYQIM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|