C21H21ClF3N3O3S — CID 24665913
N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 24665913) has the molecular formula C21H21ClF3N3O3S and a molecular weight of 487.93 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 24665913 |
| Molecular Formula | C21H21ClF3N3O3S |
| Molecular Weight | 487.93 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H21ClF3N3O3S/c22-16-4-1-14(2-5-16)12-27-9-7-17(8-10-27)26-20(29)13-32-19-6-3-15(21(23,24)25)11-18(19)28(30)31/h1-6,11,17H,7-10,12-13H2,(H,26,29) |
| InChIKey | FYMCXEZQTNFNRU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|