C15H19F3N2OS — CID 96547753
2-methylsulfanyl-N-[(3R)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]acetamide (PubChem CID 96547753) has the molecular formula C15H19F3N2OS and a molecular weight of 332.39 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[(3R)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2-methylsulfanyl-N-[(3R)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 96547753 |
| Molecular Formula | C15H19F3N2OS |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-methylsulfanyl-N-[(3R)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]acetamide |
| SMILES | CSCC(=O)N[C@@H]1CCN(Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H19F3N2OS/c1-22-10-14(21)19-13-6-7-20(9-13)8-11-2-4-12(5-3-11)15(16,17)18/h2-5,13H,6-10H2,1H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | GEJGNQVQKFTPHQ-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |