C18H25F3N4 — CID 111922769
2-methyl-1-(2-methylcyclopropyl)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine (PubChem CID 111922769) has the molecular formula C18H25F3N4 and a molecular weight of 354.42 g/mol. Its IUPAC name is 2-methyl-1-(2-methylcyclopropyl)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine.
| Compound Name | 2-methyl-1-(2-methylcyclopropyl)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111922769 |
| Molecular Formula | C18H25F3N4 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2-methyl-1-(2-methylcyclopropyl)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(/NC1CCN(Cc2ccc(C(F)(F)F)cc2)C1)NC1CC1C |
| InChI | InChI=1S/C18H25F3N4/c1-12-9-16(12)24-17(22-2)23-15-7-8-25(11-15)10-13-3-5-14(6-4-13)18(19,20)21/h3-6,12,15-16H,7-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | JMTSLXLPRZREGR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|