C21H26F3N5O — CID 111922759
1-[(2-methoxy-4-pyridinyl)methyl]-2-methyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine (PubChem CID 111922759) has the molecular formula C21H26F3N5O and a molecular weight of 421.47 g/mol. Its IUPAC name is 1-[(2-methoxy-4-pyridinyl)methyl]-2-methyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[(2-methoxy-4-pyridinyl)methyl]-2-methyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111922759 |
| Molecular Formula | C21H26F3N5O |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 1-[(2-methoxy-4-pyridinyl)methyl]-2-methyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCc1ccnc(OC)c1)NC1CCN(Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C21H26F3N5O/c1-25-20(27-12-16-7-9-26-19(11-16)30-2)28-18-8-10-29(14-18)13-15-3-5-17(6-4-15)21(22,23)24/h3-7,9,11,18H,8,10,12-14H2,1-2H3,(H2,25,27,28) |
| InChIKey | DFMGWTWNNNRCTD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|