C19H25F3IN5S — CID 111923006
2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111923006) has the molecular formula C19H25F3IN5S and a molecular weight of 539.41 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111923006 |
| Molecular Formula | C19H25F3IN5S |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnc(C)s1)NC1CCN(Cc2ccc(C(F)(F)F)cc2)C1.I |
| InChI | InChI=1S/C19H24F3N5S.HI/c1-13-24-9-17(28-13)10-25-18(23-2)26-16-7-8-27(12-16)11-14-3-5-15(6-4-14)19(20,21)22;/h3-6,9,16H,7-8,10-12H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | RDUMOWNGWPEIPU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|