C17H25F3N4 — CID 111922891
1,2-diethyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine (PubChem CID 111922891) has the molecular formula C17H25F3N4 and a molecular weight of 342.41 g/mol. Its IUPAC name is 1,2-diethyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine.
| Compound Name | 1,2-diethyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111922891 |
| Molecular Formula | C17H25F3N4 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 1,2-diethyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine |
| SMILES | CC/N=C(\NCC)NC1CCN(Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C17H25F3N4/c1-3-21-16(22-4-2)23-15-9-10-24(12-15)11-13-5-7-14(8-6-13)17(18,19)20/h5-8,15H,3-4,9-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | ZBSFHCQFZPGITD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|