C19H31F3IN5O2S — CID 111922830
1-ethyl-2-[2-(ethylsulfonylamino)ethyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111922830) has the molecular formula C19H31F3IN5O2S and a molecular weight of 577.46 g/mol. Its IUPAC name is 1-ethyl-2-[2-(ethylsulfonylamino)ethyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(ethylsulfonylamino)ethyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111922830 |
| Molecular Formula | C19H31F3IN5O2S |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | 1-ethyl-2-[2-(ethylsulfonylamino)ethyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)CC)NC1CCN(Cc2ccc(C(F)(F)F)cc2)C1.I |
| InChI | InChI=1S/C19H30F3N5O2S.HI/c1-3-23-18(24-10-11-25-30(28,29)4-2)26-17-9-12-27(14-17)13-15-5-7-16(8-6-15)19(20,21)22;/h5-8,17,25H,3-4,9-14H2,1-2H3,(H2,23,24,26);1H |
| InChIKey | QCGDNDSVISSDEU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|