C21H28F3IN4O2 — CID 111995106
1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111995106) has the molecular formula C21H28F3IN4O2 and a molecular weight of 552.38 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111995106 |
| Molecular Formula | C21H28F3IN4O2 |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccco1)NC1CCN(Cc2ccc(C(F)(F)F)cc2)C1.I |
| InChI | InChI=1S/C21H27F3N4O2.HI/c1-2-25-20(26-12-18(29)19-4-3-11-30-19)27-17-9-10-28(14-17)13-15-5-7-16(8-6-15)21(22,23)24;/h3-8,11,17-18,29H,2,9-10,12-14H2,1H3,(H2,25,26,27);1H |
| InChIKey | LDRPSGUFNTYCEQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|