C19H20F3N3O — CID 119888128
3-amino-N-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]benzamide (PubChem CID 119888128) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is 3-amino-N-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]benzamide.
| Compound Name | 3-amino-N-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 119888128 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-amino-N-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]benzamide |
| SMILES | Nc1cccc(C(=O)NC2CCN(Cc3ccc(C(F)(F)F)cc3)C2)c1 |
| InChI | InChI=1S/C19H20F3N3O/c20-19(21,22)15-6-4-13(5-7-15)11-25-9-8-17(12-25)24-18(26)14-2-1-3-16(23)10-14/h1-7,10,17H,8-9,11-12,23H2,(H,24,26) |
| InChIKey | MLABOFVSDIRJHF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|