C19H21Cl2N3O — CID 119883504
3-amino-N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 119883504) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is 3-amino-N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | 3-amino-N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 119883504 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-amino-N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | Nc1cccc(C(=O)NC2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C19H21Cl2N3O/c20-17-5-4-13(10-18(17)21)12-24-8-6-16(7-9-24)23-19(25)14-2-1-3-15(22)11-14/h1-5,10-11,16H,6-9,12,22H2,(H,23,25) |
| InChIKey | JQGQGXQKHYPECD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|