C22H25ClF3N3O — CID 46682583
1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 46682583) has the molecular formula C22H25ClF3N3O and a molecular weight of 439.91 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 46682583 |
| Molecular Formula | C22H25ClF3N3O |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | O=C(NCCc1ccc(C(F)(F)F)cc1)NC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H25ClF3N3O/c23-19-7-3-17(4-8-19)15-29-13-10-20(11-14-29)28-21(30)27-12-9-16-1-5-18(6-2-16)22(24,25)26/h1-8,20H,9-15H2,(H2,27,28,30) |
| InChIKey | QWABLNATJIRLMN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |