C14H11F3N2O3S2 — CID 35864916
2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 35864916) has the molecular formula C14H11F3N2O3S2 and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 35864916 |
| Molecular Formula | C14H11F3N2O3S2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NCc1cccs1 |
| InChI | InChI=1S/C14H11F3N2O3S2/c15-14(16,17)9-3-4-12(11(6-9)19(21)22)24-8-13(20)18-7-10-2-1-5-23-10/h1-6H,7-8H2,(H,18,20) |
| InChIKey | VWYKUVBRXAEANE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|