C13H13FN2OS2 — CID 43303693
2-(4-amino-2-fluorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 43303693) has the molecular formula C13H13FN2OS2 and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-(4-amino-2-fluorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(4-amino-2-fluorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 43303693 |
| Molecular Formula | C13H13FN2OS2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-(4-amino-2-fluorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | Nc1ccc(SCC(=O)NCc2cccs2)c(F)c1 |
| InChI | InChI=1S/C13H13FN2OS2/c14-11-6-9(15)3-4-12(11)19-8-13(17)16-7-10-2-1-5-18-10/h1-6H,7-8,15H2,(H,16,17) |
| InChIKey | KMMRJVCJBGPAAE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|