C14H13NO3S2 — CID 43242269
4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]sulfanylbenzoic acid (PubChem CID 43242269) has the molecular formula C14H13NO3S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]sulfanylbenzoic acid.
| Compound Name | 4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 43242269 |
| Molecular Formula | C14H13NO3S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]sulfanylbenzoic acid |
| SMILES | O=C(CSc1ccc(C(=O)O)cc1)NCc1cccs1 |
| InChI | InChI=1S/C14H13NO3S2/c16-13(15-8-12-2-1-7-19-12)9-20-11-5-3-10(4-6-11)14(17)18/h1-7H,8-9H2,(H,15,16)(H,17,18) |
| InChIKey | UOPZBQQIOGEEOT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |