C13H19N3O3S — CID 43521795
2-[4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]piperazin-1-yl]acetic acid (PubChem CID 43521795) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 43521795 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[4-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)NCc2cccs2)CC1 |
| InChI | InChI=1S/C13H19N3O3S/c17-12(14-8-11-2-1-7-20-11)9-15-3-5-16(6-4-15)10-13(18)19/h1-2,7H,3-6,8-10H2,(H,14,17)(H,18,19) |
| InChIKey | QNIDSMNVRQEJEG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |