C13H19FN2OS — CID 171701259
2-[4-(fluoromethyl)piperidin-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 171701259) has the molecular formula C13H19FN2OS and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-[4-(fluoromethyl)piperidin-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(fluoromethyl)piperidin-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 171701259 |
| Molecular Formula | C13H19FN2OS |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[4-(fluoromethyl)piperidin-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN1CCC(CF)CC1)NCc1cccs1 |
| InChI | InChI=1S/C13H19FN2OS/c14-8-11-3-5-16(6-4-11)10-13(17)15-9-12-2-1-7-18-12/h1-2,7,11H,3-6,8-10H2,(H,15,17) |
| InChIKey | PWTPUOUFVTZHAT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |