C16H17NO4S2 — CID 8549305
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-methoxyphenyl)sulfanylacetate (PubChem CID 8549305) has the molecular formula C16H17NO4S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-methoxyphenyl)sulfanylacetate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-methoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8549305 |
| Molecular Formula | C16H17NO4S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(4-methoxyphenyl)sulfanylacetate |
| SMILES | COc1ccc(SCC(=O)OCC(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C16H17NO4S2/c1-20-12-4-6-13(7-5-12)23-11-16(19)21-10-15(18)17-9-14-3-2-8-22-14/h2-8H,9-11H2,1H3,(H,17,18) |
| InChIKey | QESWRTSHPLANBW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |