C20H17F2NOS2 — CID 39044875
2-[bis(4-fluorophenyl)methylsulfanyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 39044875) has the molecular formula C20H17F2NOS2 and a molecular weight of 389.49 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methylsulfanyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[bis(4-fluorophenyl)methylsulfanyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 39044875 |
| Molecular Formula | C20H17F2NOS2 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methylsulfanyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CSC(c1ccc(F)cc1)c1ccc(F)cc1)NCc1cccs1 |
| InChI | InChI=1S/C20H17F2NOS2/c21-16-7-3-14(4-8-16)20(15-5-9-17(22)10-6-15)26-13-19(24)23-12-18-2-1-11-25-18/h1-11,20H,12-13H2,(H,23,24) |
| InChIKey | YFRIGPAEWOXHGE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |