C13H10ClF3N2OS2 — CID 2484290
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 2484290) has the molecular formula C13H10ClF3N2OS2 and a molecular weight of 366.82 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2484290 |
| Molecular Formula | C13H10ClF3N2OS2 |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CSc1ncc(C(F)(F)F)cc1Cl)NCc1cccs1 |
| InChI | InChI=1S/C13H10ClF3N2OS2/c14-10-4-8(13(15,16)17)5-19-12(10)22-7-11(20)18-6-9-2-1-3-21-9/h1-5H,6-7H2,(H,18,20) |
| InChIKey | LBOXCIONYZUFIM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |