C17H14ClF3N3S2+ — CID 6346328
[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-(thiophen-2-ylmethylamino)methylidene]-(thiophen-2-ylmethyl)azanium (PubChem CID 6346328) has the molecular formula C17H14ClF3N3S2+ and a molecular weight of 416.90 g/mol. Its IUPAC name is [[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-(thiophen-2-ylmethylamino)methylidene]-(thiophen-2-ylmethyl)azanium.
| Compound Name | [[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-(thiophen-2-ylmethylamino)methylidene]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 6346328 |
| Molecular Formula | C17H14ClF3N3S2+ |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | [[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-(thiophen-2-ylmethylamino)methylidene]-(thiophen-2-ylmethyl)azanium |
| SMILES | FC(F)(F)c1cnc(/C(NCc2cccs2)=[NH+]/Cc2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C17H13ClF3N3S2/c18-14-7-11(17(19,20)21)8-22-15(14)16(23-9-12-3-1-5-25-12)24-10-13-4-2-6-26-13/h1-8H,9-10H2,(H,23,24)/p+1 |
| InChIKey | FLFUPLHMXBLERI-UHFFFAOYSA-O |
| XLogP | 3.69 |
| TPSA | 38.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|