C11H9ClF3N5O — CID 138023481
3-chloro-N-[(2-methyltriazol-4-yl)methyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 138023481) has the molecular formula C11H9ClF3N5O and a molecular weight of 319.67 g/mol. Its IUPAC name is 3-chloro-N-[(2-methyltriazol-4-yl)methyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[(2-methyltriazol-4-yl)methyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 138023481 |
| Molecular Formula | C11H9ClF3N5O |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 3-chloro-N-[(2-methyltriazol-4-yl)methyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | Cn1ncc(CNC(=O)c2ncc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C11H9ClF3N5O/c1-20-18-5-7(19-20)4-17-10(21)9-8(12)2-6(3-16-9)11(13,14)15/h2-3,5H,4H2,1H3,(H,17,21) |
| InChIKey | BBNCWYLWNXJQRW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |