C14H9Cl3F3N3O — CID 22027361
2,4-dichloro-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-6-methylpyridine-3-carboxamide (PubChem CID 22027361) has the molecular formula C14H9Cl3F3N3O and a molecular weight of 398.60 g/mol. Its IUPAC name is 2,4-dichloro-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 2,4-dichloro-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 22027361 |
| Molecular Formula | C14H9Cl3F3N3O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 2,4-dichloro-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)c(C(=O)NCc2ncc(C(F)(F)F)cc2Cl)c(Cl)n1 |
| InChI | InChI=1S/C14H9Cl3F3N3O/c1-6-2-9(16)11(12(17)23-6)13(24)22-5-10-8(15)3-7(4-21-10)14(18,19)20/h2-4H,5H2,1H3,(H,22,24) |
| InChIKey | GFAJPDCDHMWDMP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|