C13H7Cl3F3N3O — CID 22027356
2,4-dichloro-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]pyridine-3-carboxamide (PubChem CID 22027356) has the molecular formula C13H7Cl3F3N3O and a molecular weight of 384.57 g/mol. Its IUPAC name is 2,4-dichloro-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2,4-dichloro-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22027356 |
| Molecular Formula | C13H7Cl3F3N3O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 2,4-dichloro-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ncc(C(F)(F)F)cc1Cl)c1c(Cl)ccnc1Cl |
| InChI | InChI=1S/C13H7Cl3F3N3O/c14-7-1-2-20-11(16)10(7)12(23)22-5-9-8(15)3-6(4-21-9)13(17,18)19/h1-4H,5H2,(H,22,23) |
| InChIKey | JQRDBKCTCFNWFS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|