C14H8Cl3F3N2O — CID 631511
2-chloro-N-[(2,4-dichlorophenyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 631511) has the molecular formula C14H8Cl3F3N2O and a molecular weight of 383.58 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-dichlorophenyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(2,4-dichlorophenyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 631511 |
| Molecular Formula | C14H8Cl3F3N2O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 2-chloro-N-[(2,4-dichlorophenyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)c1c(C(F)(F)F)ccnc1Cl |
| InChI | InChI=1S/C14H8Cl3F3N2O/c15-8-2-1-7(10(16)5-8)6-22-13(23)11-9(14(18,19)20)3-4-21-12(11)17/h1-5H,6H2,(H,22,23) |
| InChIKey | RCYBRGIWNJVFIL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|