C12H13ClF3N3O2 — CID 66989884
N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]morpholine-4-carboxamide (PubChem CID 66989884) has the molecular formula C12H13ClF3N3O2 and a molecular weight of 323.70 g/mol. Its IUPAC name is N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]morpholine-4-carboxamide.
| Compound Name | N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 66989884 |
| Molecular Formula | C12H13ClF3N3O2 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NCc1ncc(C(F)(F)F)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C12H13ClF3N3O2/c13-9-5-8(12(14,15)16)6-17-10(9)7-18-11(20)19-1-3-21-4-2-19/h5-6H,1-4,7H2,(H,18,20) |
| InChIKey | QDIULTHZZQMNIP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |