C14H15ClF3N3O2 — CID 110208637
1-acetyl-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 110208637) has the molecular formula C14H15ClF3N3O2 and a molecular weight of 349.74 g/mol. Its IUPAC name is 1-acetyl-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-acetyl-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110208637 |
| Molecular Formula | C14H15ClF3N3O2 |
| Molecular Weight | 349.74 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-acetyl-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CCCC1C(=O)NCc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H15ClF3N3O2/c1-8(22)21-4-2-3-12(21)13(23)20-7-11-10(15)5-9(6-19-11)14(16,17)18/h5-6,12H,2-4,7H2,1H3,(H,20,23) |
| InChIKey | YYVCNIKDWYIXJS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |