C13H15ClF3N3O — CID 71627819
1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]piperazin-1-yl]ethanone (PubChem CID 71627819) has the molecular formula C13H15ClF3N3O and a molecular weight of 321.73 g/mol. Its IUPAC name is 1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 71627819 |
| Molecular Formula | C13H15ClF3N3O |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C13H15ClF3N3O/c1-9(21)20-4-2-19(3-5-20)8-12-11(14)6-10(7-18-12)13(15,16)17/h6-7H,2-5,8H2,1H3 |
| InChIKey | QFHSCEGZCRLYRB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |