C13H16ClF3N4O — CID 3655511
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(4-methylpiperazin-1-yl)acetamide (PubChem CID 3655511) has the molecular formula C13H16ClF3N4O and a molecular weight of 336.75 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 3655511 |
| Molecular Formula | C13H16ClF3N4O |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(NC(=O)Cc2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C13H16ClF3N4O/c1-20-2-4-21(5-3-20)19-12(22)7-11-10(14)6-9(8-18-11)13(15,16)17/h6,8H,2-5,7H2,1H3,(H,19,22) |
| InChIKey | XAXUSYQTTVLADX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |