C14H8Cl2F6N4O — CID 5144250
N',2-bis[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetohydrazide (PubChem CID 5144250) has the molecular formula C14H8Cl2F6N4O and a molecular weight of 433.14 g/mol. Its IUPAC name is N',2-bis[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetohydrazide.
| Compound Name | N',2-bis[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetohydrazide |
|---|---|
| PubChem CID | 5144250 |
| Molecular Formula | C14H8Cl2F6N4O |
| Molecular Weight | 433.14 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | N',2-bis[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetohydrazide |
| SMILES | O=C(Cc1ncc(C(F)(F)F)cc1Cl)NNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H8Cl2F6N4O/c15-8-1-6(13(17,18)19)4-23-10(8)3-11(27)25-26-12-9(16)2-7(5-24-12)14(20,21)22/h1-2,4-5H,3H2,(H,24,26)(H,25,27) |
| InChIKey | ZBMANMNQAYBQTR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.14 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|