C8H6ClF3N2S — CID 91664064
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanethioamide (PubChem CID 91664064) has the molecular formula C8H6ClF3N2S and a molecular weight of 254.66 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanethioamide.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanethioamide |
|---|---|
| PubChem CID | 91664064 |
| Molecular Formula | C8H6ClF3N2S |
| Molecular Weight | 254.66 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanethioamide |
| SMILES | NC(=S)Cc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H6ClF3N2S/c9-5-1-4(8(10,11)12)3-14-6(5)2-7(13)15/h1,3H,2H2,(H2,13,15) |
| InChIKey | MCCPZOVEZKVIEM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.66 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|