C14H10Cl2F3N3 — CID 87950496
2-chloro-N'-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]benzenecarboximidamide (PubChem CID 87950496) has the molecular formula C14H10Cl2F3N3 and a molecular weight of 348.16 g/mol. Its IUPAC name is 2-chloro-N'-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]benzenecarboximidamide.
| Compound Name | 2-chloro-N'-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 87950496 |
| Molecular Formula | C14H10Cl2F3N3 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-chloro-N'-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]benzenecarboximidamide |
| SMILES | N/C(=N\Cc1ncc(C(F)(F)F)cc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C14H10Cl2F3N3/c15-10-4-2-1-3-9(10)13(20)22-7-12-11(16)5-8(6-21-12)14(17,18)19/h1-6H,7H2,(H2,20,22) |
| InChIKey | MAQRIXKVLDWBJL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|